C18H14BrN3OS — CID 139972662
4-(5-bromo-1H-indol-3-yl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 139972662) has the molecular formula C18H14BrN3OS and a molecular weight of 400.30 g/mol. Its IUPAC name is 4-(5-bromo-1H-indol-3-yl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(5-bromo-1H-indol-3-yl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 139972662 |
| Molecular Formula | C18H14BrN3OS |
| Molecular Weight | 400.30 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 4-(5-bromo-1H-indol-3-yl)-N-(4-methoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc(Nc2nc(-c3c[nH]c4ccc(Br)cc34)cs2)cc1 |
| InChI | InChI=1S/C18H14BrN3OS/c1-23-13-5-3-12(4-6-13)21-18-22-17(10-24-18)15-9-20-16-7-2-11(19)8-14(15)16/h2-10,20H,1H3,(H,21,22) |
| InChIKey | YWTZHXRPTJOHSP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.30 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |