C18H17NO3S3 — CID 86758665
O-methyl 4-[4-(3,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylthiophene-2-carbothioate (PubChem CID 86758665) has the molecular formula C18H17NO3S3 and a molecular weight of 391.54 g/mol. Its IUPAC name is O-methyl 4-[4-(3,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylthiophene-2-carbothioate.
| Compound Name | O-methyl 4-[4-(3,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylthiophene-2-carbothioate |
|---|---|
| PubChem CID | 86758665 |
| Molecular Formula | C18H17NO3S3 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | O-methyl 4-[4-(3,5-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylthiophene-2-carbothioate |
| SMILES | COC(=S)c1cc(-c2nc(-c3cc(OC)cc(OC)c3)cs2)c(C)s1 |
| InChI | InChI=1S/C18H17NO3S3/c1-10-14(8-16(25-10)18(23)22-4)17-19-15(9-24-17)11-5-12(20-2)7-13(6-11)21-3/h5-9H,1-4H3 |
| InChIKey | LFOWREILRCOVDO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|