C26H26N4O4S2 — CID 18537094
2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]-N-[(3,4-dimethoxyphenyl)methyl]acetamide (PubChem CID 18537094) has the molecular formula C26H26N4O4S2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]-N-[(3,4-dimethoxyphenyl)methyl]acetamide.
| Compound Name | 2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 18537094 |
| Molecular Formula | C26H26N4O4S2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]-N-[(3,4-dimethoxyphenyl)methyl]acetamide |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(OCC(=O)NCc4ccc(OC)c(OC)c4)c3)cs2)c(C)s1 |
| InChI | InChI=1S/C26H26N4O4S2/c1-15-19(11-23(36-15)25(27)28)26-30-20(14-35-26)17-5-4-6-18(10-17)34-13-24(31)29-12-16-7-8-21(32-2)22(9-16)33-3/h4-11,14H,12-13H2,1-3H3,(H3,27,28)(H,29,31) |
| InChIKey | DWJICKHELVBZNN-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|