C23H24N4O4S3 — CID 90953463
1-[2-[3-[2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]piperidine-4-carboxylic acid (PubChem CID 90953463) has the molecular formula C23H24N4O4S3 and a molecular weight of 516.67 g/mol. Its IUPAC name is 1-[2-[3-[2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-[3-[2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 90953463 |
| Molecular Formula | C23H24N4O4S3 |
| Molecular Weight | 516.67 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 1-[2-[3-[2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]piperidine-4-carboxylic acid |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(OCC(=O)N4CCC(C(=O)O)CC4)c3)cs2)c(SC)s1 |
| InChI | InChI=1S/C23H24N4O4S3/c1-32-23-16(10-18(34-23)20(24)25)21-26-17(12-33-21)14-3-2-4-15(9-14)31-11-19(28)27-7-5-13(6-8-27)22(29)30/h2-4,9-10,12-13H,5-8,11H2,1H3,(H3,24,25)(H,29,30) |
| InChIKey | UJTZTLOHEQAHHD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|