C17H18ClN3O2S3 — CID 18537467
4-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride (PubChem CID 18537467) has the molecular formula C17H18ClN3O2S3 and a molecular weight of 428.00 g/mol. Its IUPAC name is 4-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride.
| Compound Name | 4-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 18537467 |
| Molecular Formula | C17H18ClN3O2S3 |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.02 |
| IUPAC Name | 4-[4-(2,4-dimethoxyphenyl)-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cc(-c2nc(-c3ccc(OC)cc3OC)cs2)c(SC)s1 |
| InChI | InChI=1S/C17H17N3O2S3.ClH/c1-21-9-4-5-10(13(6-9)22-2)12-8-24-16(20-12)11-7-14(15(18)19)25-17(11)23-3;/h4-8H,1-3H3,(H3,18,19);1H |
| InChIKey | UIUPZJJWMHBXMW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|