C16H12F3N3OS3 — CID 18537148
5-methylsulfanyl-4-[4-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]thiophene-2-carboximidamide (PubChem CID 18537148) has the molecular formula C16H12F3N3OS3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 5-methylsulfanyl-4-[4-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]thiophene-2-carboximidamide.
| Compound Name | 5-methylsulfanyl-4-[4-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 18537148 |
| Molecular Formula | C16H12F3N3OS3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.01 |
| IUPAC Name | 5-methylsulfanyl-4-[4-[3-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]thiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(OC(F)(F)F)c3)cs2)c(SC)s1 |
| InChI | InChI=1S/C16H12F3N3OS3/c1-24-15-10(6-12(26-15)13(20)21)14-22-11(7-25-14)8-3-2-4-9(5-8)23-16(17,18)19/h2-7H,1H3,(H3,20,21) |
| InChIKey | XSCYUONGRGZQTF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 71.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|