C18H17N3O3S2 — CID 70200021
2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]propanoic acid (PubChem CID 70200021) has the molecular formula C18H17N3O3S2 and a molecular weight of 387.49 g/mol. Its IUPAC name is 2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]propanoic acid.
| Compound Name | 2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 70200021 |
| Molecular Formula | C18H17N3O3S2 |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]propanoic acid |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(OC(C)C(=O)O)c3)cs2)c(C)s1 |
| InChI | InChI=1S/C18H17N3O3S2/c1-9(18(22)23)24-12-5-3-4-11(6-12)14-8-25-17(21-14)13-7-15(16(19)20)26-10(13)2/h3-9H,1-2H3,(H3,19,20)(H,22,23) |
| InChIKey | MYZKFUHGEDJFPF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|