C24H22N4O2S3 — CID 18537130
N-benzyl-2-[3-[2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetamide (PubChem CID 18537130) has the molecular formula C24H22N4O2S3 and a molecular weight of 494.67 g/mol. Its IUPAC name is N-benzyl-2-[3-[2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetamide.
| Compound Name | N-benzyl-2-[3-[2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 18537130 |
| Molecular Formula | C24H22N4O2S3 |
| Molecular Weight | 494.67 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | N-benzyl-2-[3-[2-(5-carbamimidoyl-2-methylsulfanylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetamide |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(OCC(=O)NCc4ccccc4)c3)cs2)c(SC)s1 |
| InChI | InChI=1S/C24H22N4O2S3/c1-31-24-18(11-20(33-24)22(25)26)23-28-19(14-32-23)16-8-5-9-17(10-16)30-13-21(29)27-12-15-6-3-2-4-7-15/h2-11,14H,12-13H2,1H3,(H3,25,26)(H,27,29) |
| InChIKey | ICUIZHUBTAOBFZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.67 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|