C17H16N3O3S3+ — CID 172833565
2-[3-[2-(1-carbamimidoyl-2-methylsulfanylthiophen-1-ium-3-yl)-1,3-thiazol-4-yl]phenoxy]acetic acid (PubChem CID 172833565) has the molecular formula C17H16N3O3S3+ and a molecular weight of 406.53 g/mol. Its IUPAC name is 2-[3-[2-(1-carbamimidoyl-2-methylsulfanylthiophen-1-ium-3-yl)-1,3-thiazol-4-yl]phenoxy]acetic acid.
| Compound Name | 2-[3-[2-(1-carbamimidoyl-2-methylsulfanylthiophen-1-ium-3-yl)-1,3-thiazol-4-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 172833565 |
| Molecular Formula | C17H16N3O3S3+ |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | 2-[3-[2-(1-carbamimidoyl-2-methylsulfanylthiophen-1-ium-3-yl)-1,3-thiazol-4-yl]phenoxy]acetic acid |
| SMILES | [H]/N=C(\N)[s+]1ccc(-c2nc(-c3cccc(OCC(=O)O)c3)cs2)c1SC |
| InChI | InChI=1S/C17H15N3O3S3/c1-24-16-12(5-6-26(16)17(18)19)15-20-13(9-25-15)10-3-2-4-11(7-10)23-8-14(21)22/h2-7,9H,8H2,1H3,(H3-,18,19,21,22)/p+1 |
| InChIKey | VVNXXJLXBSJZCE-UHFFFAOYSA-O |
| XLogP | 4.15 |
| TPSA | 109.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|