C26H24N4O2S3 — CID 18537383
4-[4-[3-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide (PubChem CID 18537383) has the molecular formula C26H24N4O2S3 and a molecular weight of 520.71 g/mol. Its IUPAC name is 4-[4-[3-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide.
| Compound Name | 4-[4-[3-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide |
|---|---|
| PubChem CID | 18537383 |
| Molecular Formula | C26H24N4O2S3 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 4-[4-[3-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethoxy]phenyl]-1,3-thiazol-2-yl]-5-methylsulfanylthiophene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(OCC(=O)N4CCCc5ccccc54)c3)cs2)c(SC)s1 |
| InChI | InChI=1S/C26H24N4O2S3/c1-33-26-19(13-22(35-26)24(27)28)25-29-20(15-34-25)17-7-4-9-18(12-17)32-14-23(31)30-11-5-8-16-6-2-3-10-21(16)30/h2-4,6-7,9-10,12-13,15H,5,8,11,14H2,1H3,(H3,27,28) |
| InChIKey | YOTCKQBZTVUPLC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 92.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|