C25H25F3N4O4S2 — CID 70033553
[1-[2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]piperidin-3-yl]methyl 2,2,2-trifluoroacetate (PubChem CID 70033553) has the molecular formula C25H25F3N4O4S2 and a molecular weight of 566.63 g/mol. Its IUPAC name is [1-[2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]piperidin-3-yl]methyl 2,2,2-trifluoroacetate.
| Compound Name | [1-[2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]piperidin-3-yl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 70033553 |
| Molecular Formula | C25H25F3N4O4S2 |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | [1-[2-[3-[2-(5-carbamimidoyl-2-methylthiophen-3-yl)-1,3-thiazol-4-yl]phenoxy]acetyl]piperidin-3-yl]methyl 2,2,2-trifluoroacetate |
| SMILES | [H]/N=C(\N)c1cc(-c2nc(-c3cccc(OCC(=O)N4CCCC(COC(=O)C(F)(F)F)C4)c3)cs2)c(C)s1 |
| InChI | InChI=1S/C25H25F3N4O4S2/c1-14-18(9-20(38-14)22(29)30)23-31-19(13-37-23)16-5-2-6-17(8-16)35-12-21(33)32-7-3-4-15(10-32)11-36-24(34)25(26,27)28/h2,5-6,8-9,13,15H,3-4,7,10-12H2,1H3,(H3,29,30) |
| InChIKey | QACTWJBEEMWYGP-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|