C15H19F3N2O2 — CID 171392213
2-[3-amino-4-(trifluoromethyl)phenoxy]-1-(3-methylpiperidin-1-yl)ethanone (PubChem CID 171392213) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 2-[3-amino-4-(trifluoromethyl)phenoxy]-1-(3-methylpiperidin-1-yl)ethanone.
| Compound Name | 2-[3-amino-4-(trifluoromethyl)phenoxy]-1-(3-methylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 171392213 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-[3-amino-4-(trifluoromethyl)phenoxy]-1-(3-methylpiperidin-1-yl)ethanone |
| SMILES | CC1CCCN(C(=O)COc2ccc(C(F)(F)F)c(N)c2)C1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-10-3-2-6-20(8-10)14(21)9-22-11-4-5-12(13(19)7-11)15(16,17)18/h4-5,7,10H,2-3,6,8-9,19H2,1H3 |
| InChIKey | HICCULSIFGHPEB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|