C15H16F6N2O2 — CID 171392209
2-[3-amino-4-(trifluoromethyl)phenoxy]-1-[4-(trifluoromethyl)piperidin-1-yl]ethanone (PubChem CID 171392209) has the molecular formula C15H16F6N2O2 and a molecular weight of 370.29 g/mol. Its IUPAC name is 2-[3-amino-4-(trifluoromethyl)phenoxy]-1-[4-(trifluoromethyl)piperidin-1-yl]ethanone.
| Compound Name | 2-[3-amino-4-(trifluoromethyl)phenoxy]-1-[4-(trifluoromethyl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 171392209 |
| Molecular Formula | C15H16F6N2O2 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 2-[3-amino-4-(trifluoromethyl)phenoxy]-1-[4-(trifluoromethyl)piperidin-1-yl]ethanone |
| SMILES | Nc1cc(OCC(=O)N2CCC(C(F)(F)F)CC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C15H16F6N2O2/c16-14(17,18)9-3-5-23(6-4-9)13(24)8-25-10-1-2-11(12(22)7-10)15(19,20)21/h1-2,7,9H,3-6,8,22H2 |
| InChIKey | XIKFBHCBIXEPLY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|