C16H9ClF3N3O4S2 — CID 112769139
2-chloro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 112769139) has the molecular formula C16H9ClF3N3O4S2 and a molecular weight of 463.85 g/mol. Its IUPAC name is 2-chloro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 112769139 |
| Molecular Formula | C16H9ClF3N3O4S2 |
| Molecular Weight | 463.85 g/mol |
| Exact Mass | 462.97 |
| IUPAC Name | 2-chloro-N-[4-(3-nitrophenyl)-1,3-thiazol-2-yl]-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(-c2csc(NS(=O)(=O)c3cc(C(F)(F)F)ccc3Cl)n2)c1 |
| InChI | InChI=1S/C16H9ClF3N3O4S2/c17-12-5-4-10(16(18,19)20)7-14(12)29(26,27)22-15-21-13(8-28-15)9-2-1-3-11(6-9)23(24)25/h1-8H,(H,21,22) |
| InChIKey | RIBWCANNUIGUNH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.85 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|