C25H18Cl2N4O4S2 — CID 18899997
N-[3-[1-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 18899997) has the molecular formula C25H18Cl2N4O4S2 and a molecular weight of 573.48 g/mol. Its IUPAC name is N-[3-[1-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[1-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 18899997 |
| Molecular Formula | C25H18Cl2N4O4S2 |
| Molecular Weight | 573.48 g/mol |
| Exact Mass | 572.01 |
| IUPAC Name | N-[3-[1-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | CC(Sc1cccc(NC(=O)c2cccc([N+](=O)[O-])c2)c1)C(=O)Nc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C25H18Cl2N4O4S2/c1-14(23(32)30-25-29-22(13-36-25)20-9-8-16(26)11-21(20)27)37-19-7-3-5-17(12-19)28-24(33)15-4-2-6-18(10-15)31(34)35/h2-14H,1H3,(H,28,33)(H,29,30,32) |
| InChIKey | UTUIJNBKOOLGLH-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.48 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|