C34H25Cl2N5O5S2 — CID 19302436
N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 19302436) has the molecular formula C34H25Cl2N5O5S2 and a molecular weight of 718.64 g/mol. Its IUPAC name is N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 19302436 |
| Molecular Formula | C34H25Cl2N5O5S2 |
| Molecular Weight | 718.64 g/mol |
| Exact Mass | 717.07 |
| IUPAC Name | N-[(E)-1-(2,4-dichlorophenyl)-3-[3-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1cccc(NC(=O)/C(=C\c2ccc(Cl)cc2Cl)NC(=O)c2ccccc2)c1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C34H25Cl2N5O5S2/c1-20(31(42)40-34-39-30(19-47-34)23-9-5-11-26(15-23)41(45)46)48-27-12-6-10-25(18-27)37-33(44)29(16-22-13-14-24(35)17-28(22)36)38-32(43)21-7-3-2-4-8-21/h2-20H,1H3,(H,37,44)(H,38,43)(H,39,40,42)/b29-16+ |
| InChIKey | OFZBCMFYKVHFRG-MUFRIFMGSA-N |
| XLogP | 8.55 |
| TPSA | 143.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.64 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|