C33H26N6O5S2 — CID 22192647
N-[(Z)-3-[4-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide (PubChem CID 22192647) has the molecular formula C33H26N6O5S2 and a molecular weight of 650.74 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22192647 |
| Molecular Formula | C33H26N6O5S2 |
| Molecular Weight | 650.74 g/mol |
| Exact Mass | 650.14 |
| IUPAC Name | N-[(Z)-3-[4-[1-[[4-(3-nitrophenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-3-oxo-1-pyridin-3-ylprop-1-en-2-yl]benzamide |
| SMILES | CC(Sc1ccc(NC(=O)/C(=C/c2cccnc2)NC(=O)c2ccccc2)cc1)C(=O)Nc1nc(-c2cccc([N+](=O)[O-])c2)cs1 |
| InChI | InChI=1S/C33H26N6O5S2/c1-21(30(40)38-33-37-29(20-45-33)24-10-5-11-26(18-24)39(43)44)46-27-14-12-25(13-15-27)35-32(42)28(17-22-7-6-16-34-19-22)36-31(41)23-8-3-2-4-9-23/h2-21H,1H3,(H,35,42)(H,36,41)(H,37,38,40)/b28-17- |
| InChIKey | IXINLGRUCCQPCI-QRQIAZFYSA-N |
| XLogP | 6.64 |
| TPSA | 156.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.74 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|