C35H29N5O6S2 — CID 22191517
N-[(Z)-3-[4-[1-[[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 22191517) has the molecular formula C35H29N5O6S2 and a molecular weight of 679.78 g/mol. Its IUPAC name is N-[(Z)-3-[4-[1-[[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[(Z)-3-[4-[1-[[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 22191517 |
| Molecular Formula | C35H29N5O6S2 |
| Molecular Weight | 679.78 g/mol |
| Exact Mass | 679.16 |
| IUPAC Name | N-[(Z)-3-[4-[1-[[4-(3-methoxyphenyl)-1,3-thiazol-2-yl]amino]-1-oxopropan-2-yl]sulfanylanilino]-1-(2-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | COc1cccc(-c2csc(NC(=O)C(C)Sc3ccc(NC(=O)/C(=C/c4ccccc4[N+](=O)[O-])NC(=O)c4ccccc4)cc3)n2)c1 |
| InChI | InChI=1S/C35H29N5O6S2/c1-22(32(41)39-35-38-30(21-47-35)24-12-8-13-27(19-24)46-2)48-28-17-15-26(16-18-28)36-34(43)29(37-33(42)23-9-4-3-5-10-23)20-25-11-6-7-14-31(25)40(44)45/h3-22H,1-2H3,(H,36,43)(H,37,42)(H,38,39,41)/b29-20- |
| InChIKey | RSZMGXPJAKKKII-BRPDVVIDSA-N |
| XLogP | 7.26 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.78 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|