C17H22N4O2S — CID 39894500
ethyl 4-[(2-anilino-1,3-thiazol-4-yl)methyl]piperazine-1-carboxylate (PubChem CID 39894500) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is ethyl 4-[(2-anilino-1,3-thiazol-4-yl)methyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(2-anilino-1,3-thiazol-4-yl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 39894500 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | ethyl 4-[(2-anilino-1,3-thiazol-4-yl)methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2csc(Nc3ccccc3)n2)CC1 |
| InChI | InChI=1S/C17H22N4O2S/c1-2-23-17(22)21-10-8-20(9-11-21)12-15-13-24-16(19-15)18-14-6-4-3-5-7-14/h3-7,13H,2,8-12H2,1H3,(H,18,19) |
| InChIKey | GHFYCFVNTUYUTL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |