C26H39N3O3S — CID 58791824
ethyl 1-[[2-(4-octoxyanilino)-1,3-thiazol-4-yl]methyl]piperidine-4-carboxylate (PubChem CID 58791824) has the molecular formula C26H39N3O3S and a molecular weight of 473.68 g/mol. Its IUPAC name is ethyl 1-[[2-(4-octoxyanilino)-1,3-thiazol-4-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[2-(4-octoxyanilino)-1,3-thiazol-4-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 58791824 |
| Molecular Formula | C26H39N3O3S |
| Molecular Weight | 473.68 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | ethyl 1-[[2-(4-octoxyanilino)-1,3-thiazol-4-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(CN3CCC(C(=O)OCC)CC3)cs2)cc1 |
| InChI | InChI=1S/C26H39N3O3S/c1-3-5-6-7-8-9-18-32-24-12-10-22(11-13-24)27-26-28-23(20-33-26)19-29-16-14-21(15-17-29)25(30)31-4-2/h10-13,20-21H,3-9,14-19H2,1-2H3,(H,27,28) |
| InChIKey | GXRXHWACSWQCGE-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.68 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|