C21H28FN3O3S — CID 58792009
1-[[2-(3-fluoro-4-pentoxyanilino)-1,3-thiazol-4-yl]methyl]piperidine-3-carboxylic acid (PubChem CID 58792009) has the molecular formula C21H28FN3O3S and a molecular weight of 421.54 g/mol. Its IUPAC name is 1-[[2-(3-fluoro-4-pentoxyanilino)-1,3-thiazol-4-yl]methyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[[2-(3-fluoro-4-pentoxyanilino)-1,3-thiazol-4-yl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 58792009 |
| Molecular Formula | C21H28FN3O3S |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 1-[[2-(3-fluoro-4-pentoxyanilino)-1,3-thiazol-4-yl]methyl]piperidine-3-carboxylic acid |
| SMILES | CCCCCOc1ccc(Nc2nc(CN3CCCC(C(=O)O)C3)cs2)cc1F |
| InChI | InChI=1S/C21H28FN3O3S/c1-2-3-4-10-28-19-8-7-16(11-18(19)22)23-21-24-17(14-29-21)13-25-9-5-6-15(12-25)20(26)27/h7-8,11,14-15H,2-6,9-10,12-13H2,1H3,(H,23,24)(H,26,27) |
| InChIKey | ZNDCOMFSNQYJGQ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|