C21H31FN4OS — CID 58791980
4-[[3-(dimethylamino)pyrrolidin-1-yl]methyl]-N-(3-fluoro-4-pentoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 58791980) has the molecular formula C21H31FN4OS and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[[3-(dimethylamino)pyrrolidin-1-yl]methyl]-N-(3-fluoro-4-pentoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-[[3-(dimethylamino)pyrrolidin-1-yl]methyl]-N-(3-fluoro-4-pentoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791980 |
| Molecular Formula | C21H31FN4OS |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 4-[[3-(dimethylamino)pyrrolidin-1-yl]methyl]-N-(3-fluoro-4-pentoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1ccc(Nc2nc(CN3CCC(N(C)C)C3)cs2)cc1F |
| InChI | InChI=1S/C21H31FN4OS/c1-4-5-6-11-27-20-8-7-16(12-19(20)22)23-21-24-17(15-28-21)13-26-10-9-18(14-26)25(2)3/h7-8,12,15,18H,4-6,9-11,13-14H2,1-3H3,(H,23,24) |
| InChIKey | WSVAWUVJKHQBET-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|