C22H28F3N3O3S — CID 58791317
1-[[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl]piperidine-4-carboxylic acid (PubChem CID 58791317) has the molecular formula C22H28F3N3O3S and a molecular weight of 471.55 g/mol. Its IUPAC name is 1-[[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 58791317 |
| Molecular Formula | C22H28F3N3O3S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-[[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl]piperidine-4-carboxylic acid |
| SMILES | CCCCCOc1ccc(Nc2nc(CN3CCC(C(=O)O)CC3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C22H28F3N3O3S/c1-2-3-4-11-31-19-6-5-16(12-18(19)22(23,24)25)26-21-27-17(14-32-21)13-28-9-7-15(8-10-28)20(29)30/h5-6,12,14-15H,2-4,7-11,13H2,1H3,(H,26,27)(H,29,30) |
| InChIKey | JZCAQYNXPYPKDZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|