C21H25F3N2O3S — CID 58792028
ethyl 1-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]cyclopropane-1-carboxylate (PubChem CID 58792028) has the molecular formula C21H25F3N2O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is ethyl 1-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 58792028 |
| Molecular Formula | C21H25F3N2O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | ethyl 1-[2-[4-pentoxy-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]cyclopropane-1-carboxylate |
| SMILES | CCCCCOc1ccc(Nc2nc(C3(C(=O)OCC)CC3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C21H25F3N2O3S/c1-3-5-6-11-29-16-8-7-14(12-15(16)21(22,23)24)25-19-26-17(13-30-19)20(9-10-20)18(27)28-4-2/h7-8,12-13H,3-6,9-11H2,1-2H3,(H,25,26) |
| InChIKey | PFGYXXHAJMPQPG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|