C19H19F3N4OS — CID 58791233
N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-pyrimidin-5-yl-1,3-thiazol-2-amine (PubChem CID 58791233) has the molecular formula C19H19F3N4OS and a molecular weight of 408.45 g/mol. Its IUPAC name is N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-pyrimidin-5-yl-1,3-thiazol-2-amine.
| Compound Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-pyrimidin-5-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58791233 |
| Molecular Formula | C19H19F3N4OS |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | N-[4-pentoxy-3-(trifluoromethyl)phenyl]-4-pyrimidin-5-yl-1,3-thiazol-2-amine |
| SMILES | CCCCCOc1ccc(Nc2nc(-c3cncnc3)cs2)cc1C(F)(F)F |
| InChI | InChI=1S/C19H19F3N4OS/c1-2-3-4-7-27-17-6-5-14(8-15(17)19(20,21)22)25-18-26-16(11-28-18)13-9-23-12-24-10-13/h5-6,8-12H,2-4,7H2,1H3,(H,25,26) |
| InChIKey | COFYOMBSXIBUHC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|