C26H34F2N2OS — CID 143328801
4-[(3,4-difluorophenyl)methyl]-N-(4-octoxyphenyl)-1,3-thiazol-2-amine;ethane (PubChem CID 143328801) has the molecular formula C26H34F2N2OS and a molecular weight of 460.63 g/mol. Its IUPAC name is 4-[(3,4-difluorophenyl)methyl]-N-(4-octoxyphenyl)-1,3-thiazol-2-amine;ethane.
| Compound Name | 4-[(3,4-difluorophenyl)methyl]-N-(4-octoxyphenyl)-1,3-thiazol-2-amine;ethane |
|---|---|
| PubChem CID | 143328801 |
| Molecular Formula | C26H34F2N2OS |
| Molecular Weight | 460.63 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 4-[(3,4-difluorophenyl)methyl]-N-(4-octoxyphenyl)-1,3-thiazol-2-amine;ethane |
| SMILES | CC.CCCCCCCCOc1ccc(Nc2nc(Cc3ccc(F)c(F)c3)cs2)cc1 |
| InChI | InChI=1S/C24H28F2N2OS.C2H6/c1-2-3-4-5-6-7-14-29-21-11-9-19(10-12-21)27-24-28-20(17-30-24)15-18-8-13-22(25)23(26)16-18;1-2/h8-13,16-17H,2-7,14-15H2,1H3,(H,27,28);1-2H3 |
| InChIKey | QKMCQGQEDYNWHB-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.63 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|