C22H26N2O2S — CID 58791613
3-[2-(4-heptoxyanilino)-1,3-thiazol-4-yl]phenol (PubChem CID 58791613) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 3-[2-(4-heptoxyanilino)-1,3-thiazol-4-yl]phenol.
| Compound Name | 3-[2-(4-heptoxyanilino)-1,3-thiazol-4-yl]phenol |
|---|---|
| PubChem CID | 58791613 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 3-[2-(4-heptoxyanilino)-1,3-thiazol-4-yl]phenol |
| SMILES | CCCCCCCOc1ccc(Nc2nc(-c3cccc(O)c3)cs2)cc1 |
| InChI | InChI=1S/C22H26N2O2S/c1-2-3-4-5-6-14-26-20-12-10-18(11-13-20)23-22-24-21(16-27-22)17-8-7-9-19(25)15-17/h7-13,15-16,25H,2-6,14H2,1H3,(H,23,24) |
| InChIKey | GGYBOZPNUNOYQM-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|