C24H29N3OS2 — CID 87431290
4-(3a,7a-dihydro-1,3-benzothiazol-2-yl)-N-(4-octoxyphenyl)-1,3-thiazol-2-amine (PubChem CID 87431290) has the molecular formula C24H29N3OS2 and a molecular weight of 439.65 g/mol. Its IUPAC name is 4-(3a,7a-dihydro-1,3-benzothiazol-2-yl)-N-(4-octoxyphenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(3a,7a-dihydro-1,3-benzothiazol-2-yl)-N-(4-octoxyphenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 87431290 |
| Molecular Formula | C24H29N3OS2 |
| Molecular Weight | 439.65 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 4-(3a,7a-dihydro-1,3-benzothiazol-2-yl)-N-(4-octoxyphenyl)-1,3-thiazol-2-amine |
| SMILES | CCCCCCCCOc1ccc(Nc2nc(C3=NC4C=CC=CC4S3)cs2)cc1 |
| InChI | InChI=1S/C24H29N3OS2/c1-2-3-4-5-6-9-16-28-19-14-12-18(13-15-19)25-24-27-21(17-29-24)23-26-20-10-7-8-11-22(20)30-23/h7-8,10-15,17,20,22H,2-6,9,16H2,1H3,(H,25,27) |
| InChIKey | MJJFGKADSKBJRM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.65 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|