C44H36N12 — CID 141338844
2-N-[2-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]-1,2-diphenylethenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 141338844) has the molecular formula C44H36N12 and a molecular weight of 732.86 g/mol. Its IUPAC name is 2-N-[2-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]-1,2-diphenylethenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[2-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]-1,2-diphenylethenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 141338844 |
| Molecular Formula | C44H36N12 |
| Molecular Weight | 732.86 g/mol |
| Exact Mass | 732.32 |
| IUPAC Name | 2-N-[2-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]-1,2-diphenylethenyl]-4-N,6-N-diphenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(Nc2nc(NC(=C(Nc3nc(Nc4ccccc4)nc(Nc4ccccc4)n3)c3ccccc3)c3ccccc3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C44H36N12/c1-7-19-31(20-8-1)37(49-43-53-39(45-33-23-11-3-12-24-33)51-40(54-43)46-34-25-13-4-14-26-34)38(32-21-9-2-10-22-32)50-44-55-41(47-35-27-15-5-16-28-35)52-42(56-44)48-36-29-17-6-18-30-36/h1-30H,(H3,45,46,49,51,53,54)(H3,47,48,50,52,55,56) |
| InChIKey | PDNCVAAXSCAPTF-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.86 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|