C40H34N8 — CID 159020840
2-N,4-N-bis(4-anilinophenyl)-6-N-(4-benzylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 159020840) has the molecular formula C40H34N8 and a molecular weight of 626.77 g/mol. Its IUPAC name is 2-N,4-N-bis(4-anilinophenyl)-6-N-(4-benzylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N-bis(4-anilinophenyl)-6-N-(4-benzylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 159020840 |
| Molecular Formula | C40H34N8 |
| Molecular Weight | 626.77 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | 2-N,4-N-bis(4-anilinophenyl)-6-N-(4-benzylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(Cc2ccc(Nc3nc(Nc4ccc(Nc5ccccc5)cc4)nc(Nc4ccc(Nc5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C40H34N8/c1-4-10-29(11-5-1)28-30-16-18-35(19-17-30)43-38-46-39(44-36-24-20-33(21-25-36)41-31-12-6-2-7-13-31)48-40(47-38)45-37-26-22-34(23-27-37)42-32-14-8-3-9-15-32/h1-27,41-42H,28H2,(H3,43,44,45,46,47,48) |
| InChIKey | UEISOIAVRUCCAB-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.77 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |