C23H21N5O — CID 58321884
6-[(4-methoxyphenyl)methyl]-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine (PubChem CID 58321884) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is 6-[(4-methoxyphenyl)methyl]-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(4-methoxyphenyl)methyl]-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 58321884 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 6-[(4-methoxyphenyl)methyl]-2-N,4-N-diphenyl-1,3,5-triazine-2,4-diamine |
| SMILES | COc1ccc(Cc2nc(Nc3ccccc3)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H21N5O/c1-29-20-14-12-17(13-15-20)16-21-26-22(24-18-8-4-2-5-9-18)28-23(27-21)25-19-10-6-3-7-11-19/h2-15H,16H2,1H3,(H2,24,25,26,27,28) |
| InChIKey | HDIDXYRFXYMAQI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |