C26H26N4O2 — CID 123556531
4,6-bis[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)-1,3,5-triazin-2-amine (PubChem CID 123556531) has the molecular formula C26H26N4O2 and a molecular weight of 426.52 g/mol. Its IUPAC name is 4,6-bis[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 123556531 |
| Molecular Formula | C26H26N4O2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.21 |
| IUPAC Name | 4,6-bis[(4-methoxyphenyl)methyl]-N-(3-methylphenyl)-1,3,5-triazin-2-amine |
| SMILES | COc1ccc(Cc2nc(Cc3ccc(OC)cc3)nc(Nc3cccc(C)c3)n2)cc1 |
| InChI | InChI=1S/C26H26N4O2/c1-18-5-4-6-21(15-18)27-26-29-24(16-19-7-11-22(31-2)12-8-19)28-25(30-26)17-20-9-13-23(32-3)14-10-20/h4-15H,16-17H2,1-3H3,(H,27,28,29,30) |
| InChIKey | VUUDOAWBOLDDGQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |