C25H23BrN4 — CID 58090749
N-(4-bromophenyl)-4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-amine (PubChem CID 58090749) has the molecular formula C25H23BrN4 and a molecular weight of 459.39 g/mol. Its IUPAC name is N-(4-bromophenyl)-4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-amine.
| Compound Name | N-(4-bromophenyl)-4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 58090749 |
| Molecular Formula | C25H23BrN4 |
| Molecular Weight | 459.39 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-(4-bromophenyl)-4,6-bis[(3-methylphenyl)methyl]-1,3,5-triazin-2-amine |
| SMILES | Cc1cccc(Cc2nc(Cc3cccc(C)c3)nc(Nc3ccc(Br)cc3)n2)c1 |
| InChI | InChI=1S/C25H23BrN4/c1-17-5-3-7-19(13-17)15-23-28-24(16-20-8-4-6-18(2)14-20)30-25(29-23)27-22-11-9-21(26)10-12-22/h3-14H,15-16H2,1-2H3,(H,27,28,29,30) |
| InChIKey | XEALAJYMZURRMW-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.39 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |