C38H32N10O4 — CID 159987030
3-[[4-[3-[[4,6-bis(3-hydroxyanilino)-1,3,5-triazin-2-yl]methyl]anilino]-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]methyl]phenol (PubChem CID 159987030) has the molecular formula C38H32N10O4 and a molecular weight of 692.74 g/mol. Its IUPAC name is 3-[[4-[3-[[4,6-bis(3-hydroxyanilino)-1,3,5-triazin-2-yl]methyl]anilino]-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]methyl]phenol.
| Compound Name | 3-[[4-[3-[[4,6-bis(3-hydroxyanilino)-1,3,5-triazin-2-yl]methyl]anilino]-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]methyl]phenol |
|---|---|
| PubChem CID | 159987030 |
| Molecular Formula | C38H32N10O4 |
| Molecular Weight | 692.74 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | 3-[[4-[3-[[4,6-bis(3-hydroxyanilino)-1,3,5-triazin-2-yl]methyl]anilino]-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]methyl]phenol |
| SMILES | Oc1cccc(Cc2nc(Nc3cccc(O)c3)nc(Nc3cccc(Cc4nc(Nc5cccc(O)c5)nc(Nc5cccc(O)c5)n4)c3)n2)c1 |
| InChI | InChI=1S/C38H32N10O4/c49-29-12-2-7-24(17-29)19-34-45-35(47-38(46-34)42-28-11-5-15-32(52)22-28)39-25-8-1-6-23(16-25)18-33-43-36(40-26-9-3-13-30(50)20-26)48-37(44-33)41-27-10-4-14-31(51)21-27/h1-17,20-22,49-52H,18-19H2,(H2,39,42,45,46,47)(H2,40,41,43,44,48) |
| InChIKey | BESSUJNEKHIIIA-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 206.38 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.74 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |