C19H14ClN5O2 — CID 171400055
2-[[4-chloro-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]amino]naphthalen-1-ol (PubChem CID 171400055) has the molecular formula C19H14ClN5O2 and a molecular weight of 379.81 g/mol. Its IUPAC name is 2-[[4-chloro-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]amino]naphthalen-1-ol.
| Compound Name | 2-[[4-chloro-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]amino]naphthalen-1-ol |
|---|---|
| PubChem CID | 171400055 |
| Molecular Formula | C19H14ClN5O2 |
| Molecular Weight | 379.81 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | 2-[[4-chloro-6-(3-hydroxyanilino)-1,3,5-triazin-2-yl]amino]naphthalen-1-ol |
| SMILES | Oc1cccc(Nc2nc(Cl)nc(Nc3ccc4ccccc4c3O)n2)c1 |
| InChI | InChI=1S/C19H14ClN5O2/c20-17-23-18(21-12-5-3-6-13(26)10-12)25-19(24-17)22-15-9-8-11-4-1-2-7-14(11)16(15)27/h1-10,26-27H,(H2,21,22,23,24,25) |
| InChIKey | SICUYLQWFCSPGS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.81 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|