C15H14B2ClN5O4 — CID 132915588
[3-[[4-(3-boronoanilino)-6-chloro-1,3,5-triazin-2-yl]amino]phenyl]boronic acid (PubChem CID 132915588) has the molecular formula C15H14B2ClN5O4 and a molecular weight of 385.39 g/mol. Its IUPAC name is [3-[[4-(3-boronoanilino)-6-chloro-1,3,5-triazin-2-yl]amino]phenyl]boronic acid.
| Compound Name | [3-[[4-(3-boronoanilino)-6-chloro-1,3,5-triazin-2-yl]amino]phenyl]boronic acid |
|---|---|
| PubChem CID | 132915588 |
| Molecular Formula | C15H14B2ClN5O4 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | [3-[[4-(3-boronoanilino)-6-chloro-1,3,5-triazin-2-yl]amino]phenyl]boronic acid |
| SMILES | OB(O)c1cccc(Nc2nc(Cl)nc(Nc3cccc(B(O)O)c3)n2)c1 |
| InChI | InChI=1S/C15H14B2ClN5O4/c18-13-21-14(19-11-5-1-3-9(7-11)16(24)25)23-15(22-13)20-12-6-2-4-10(8-12)17(26)27/h1-8,24-27H,(H2,19,20,21,22,23) |
| InChIKey | DOAZGQNAXHVWTO-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 143.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|