C17H16ClN5O9S3 — CID 155077928
4-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid (PubChem CID 155077928) has the molecular formula C17H16ClN5O9S3 and a molecular weight of 566.00 g/mol. Its IUPAC name is 4-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid.
| Compound Name | 4-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 155077928 |
| Molecular Formula | C17H16ClN5O9S3 |
| Molecular Weight | 566.00 g/mol |
| Exact Mass | 564.98 |
| IUPAC Name | 4-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]benzenesulfonic acid |
| SMILES | O=S(=O)(O)OCCS(=O)(=O)c1cccc(Nc2nc(Cl)nc(Nc3ccc(S(=O)(=O)O)cc3)n2)c1 |
| InChI | InChI=1S/C17H16ClN5O9S3/c18-15-21-16(19-11-4-6-13(7-5-11)34(26,27)28)23-17(22-15)20-12-2-1-3-14(10-12)33(24,25)9-8-32-35(29,30)31/h1-7,10H,8-9H2,(H,26,27,28)(H,29,30,31)(H2,19,20,21,22,23) |
| InChIKey | HRZOBKPMHWOSRP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 214.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.00 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|