C27H23ClN8O16S5 — CID 135470494
2-amino-6-[[5-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid (PubChem CID 135470494) has the molecular formula C27H23ClN8O16S5 and a molecular weight of 911.31 g/mol. Its IUPAC name is 2-amino-6-[[5-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid.
| Compound Name | 2-amino-6-[[5-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid |
|---|---|
| PubChem CID | 135470494 |
| Molecular Formula | C27H23ClN8O16S5 |
| Molecular Weight | 911.31 g/mol |
| Exact Mass | 909.95 |
| IUPAC Name | 2-amino-6-[[5-[[4-chloro-6-[3-(2-sulfooxyethylsulfonyl)anilino]-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxynaphthalene-1,7-disulfonic acid |
| SMILES | Nc1ccc2c(O)c(/N=N/c3cc(Nc4nc(Cl)nc(Nc5cccc(S(=O)(=O)CCOS(=O)(=O)O)c5)n4)ccc3S(=O)(=O)O)c(S(=O)(=O)O)cc2c1S(=O)(=O)O |
| InChI | InChI=1S/C27H23ClN8O16S5/c28-25-32-26(30-13-2-1-3-15(10-13)53(38,39)9-8-52-57(49,50)51)34-27(33-25)31-14-4-7-20(54(40,41)42)19(11-14)35-36-22-21(55(43,44)45)12-17-16(23(22)37)5-6-18(29)24(17)56(46,47)48/h1-7,10-12,37H,8-9,29H2,(H,40,41,42)(H,43,44,45)(H,46,47,48)(H,49,50,51)(H2,30,31,32,33,34)/b36-35+ |
| InChIKey | YAOJHSCSDNBBDD-ULDVOPSXSA-N |
| XLogP | 3.20 |
| TPSA | 394.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|