C16H15ClN4O6S2 — CID 89361531
2-[6-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalen-2-yl]sulfonylethyl hydrogen sulfate (PubChem CID 89361531) has the molecular formula C16H15ClN4O6S2 and a molecular weight of 458.91 g/mol. Its IUPAC name is 2-[6-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalen-2-yl]sulfonylethyl hydrogen sulfate.
| Compound Name | 2-[6-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalen-2-yl]sulfonylethyl hydrogen sulfate |
|---|---|
| PubChem CID | 89361531 |
| Molecular Formula | C16H15ClN4O6S2 |
| Molecular Weight | 458.91 g/mol |
| Exact Mass | 458.01 |
| IUPAC Name | 2-[6-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]naphthalen-2-yl]sulfonylethyl hydrogen sulfate |
| SMILES | Cc1nc(Cl)nc(Nc2ccc3cc(S(=O)(=O)CCOS(=O)(=O)O)ccc3c2)n1 |
| InChI | InChI=1S/C16H15ClN4O6S2/c1-10-18-15(17)21-16(19-10)20-13-4-2-12-9-14(5-3-11(12)8-13)28(22,23)7-6-27-29(24,25)26/h2-5,8-9H,6-7H2,1H3,(H,24,25,26)(H,18,19,20,21) |
| InChIKey | NYCQSIJLHSRANW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 148.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.91 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|