C22H20ClN5O8S3 — CID 142234891
7-[[4-chloro-6-[4-(2-sulfooxyethylsulfanyl)anilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-methylnaphthalene-2-sulfonic acid (PubChem CID 142234891) has the molecular formula C22H20ClN5O8S3 and a molecular weight of 614.08 g/mol. Its IUPAC name is 7-[[4-chloro-6-[4-(2-sulfooxyethylsulfanyl)anilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-methylnaphthalene-2-sulfonic acid.
| Compound Name | 7-[[4-chloro-6-[4-(2-sulfooxyethylsulfanyl)anilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-methylnaphthalene-2-sulfonic acid |
|---|---|
| PubChem CID | 142234891 |
| Molecular Formula | C22H20ClN5O8S3 |
| Molecular Weight | 614.08 g/mol |
| Exact Mass | 613.02 |
| IUPAC Name | 7-[[4-chloro-6-[4-(2-sulfooxyethylsulfanyl)anilino]-1,3,5-triazin-2-yl]amino]-4-hydroxy-3-methylnaphthalene-2-sulfonic acid |
| SMILES | Cc1c(S(=O)(=O)O)cc2cc(Nc3nc(Cl)nc(Nc4ccc(SCCOS(=O)(=O)O)cc4)n3)ccc2c1O |
| InChI | InChI=1S/C22H20ClN5O8S3/c1-12-18(38(30,31)32)11-13-10-15(4-7-17(13)19(12)29)25-22-27-20(23)26-21(28-22)24-14-2-5-16(6-3-14)37-9-8-36-39(33,34)35/h2-7,10-11,29H,8-9H2,1H3,(H,30,31,32)(H,33,34,35)(H2,24,25,26,27,28) |
| InChIKey | KWGAPOYUGKKHIH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 200.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.08 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|