C11H10Cl2N4O4S — CID 101054965
2-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]ethyl hydrogen sulfate (PubChem CID 101054965) has the molecular formula C11H10Cl2N4O4S and a molecular weight of 365.20 g/mol. Its IUPAC name is 2-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]ethyl hydrogen sulfate.
| Compound Name | 2-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 101054965 |
| Molecular Formula | C11H10Cl2N4O4S |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | 2-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl]ethyl hydrogen sulfate |
| SMILES | O=S(=O)(O)OCCc1ccc(Nc2nc(Cl)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C11H10Cl2N4O4S/c12-9-15-10(13)17-11(16-9)14-8-3-1-7(2-4-8)5-6-21-22(18,19)20/h1-4H,5-6H2,(H,18,19,20)(H,14,15,16,17) |
| InChIKey | HYOHORZYVMJMGT-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|