C9H6Cl2N4O3S — CID 56978378
[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl] hydrogen sulfite (PubChem CID 56978378) has the molecular formula C9H6Cl2N4O3S and a molecular weight of 321.15 g/mol. Its IUPAC name is [4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl] hydrogen sulfite.
| Compound Name | [4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl] hydrogen sulfite |
|---|---|
| PubChem CID | 56978378 |
| Molecular Formula | C9H6Cl2N4O3S |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | [4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenyl] hydrogen sulfite |
| SMILES | O=S(O)Oc1ccc(Nc2nc(Cl)nc(Cl)n2)cc1 |
| InChI | InChI=1S/C9H6Cl2N4O3S/c10-7-13-8(11)15-9(14-7)12-5-1-3-6(4-2-5)18-19(16)17/h1-4H,(H,16,17)(H,12,13,14,15) |
| InChIKey | OCABUXACFGWHEQ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 97.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|