C18H10Cl4N8O — CID 102176522
4,6-dichloro-N-[4-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenoxy]phenyl]-1,3,5-triazin-2-amine (PubChem CID 102176522) has the molecular formula C18H10Cl4N8O and a molecular weight of 496.15 g/mol. Its IUPAC name is 4,6-dichloro-N-[4-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenoxy]phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-[4-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenoxy]phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 102176522 |
| Molecular Formula | C18H10Cl4N8O |
| Molecular Weight | 496.15 g/mol |
| Exact Mass | 493.97 |
| IUPAC Name | 4,6-dichloro-N-[4-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]phenoxy]phenyl]-1,3,5-triazin-2-amine |
| SMILES | Clc1nc(Cl)nc(Nc2ccc(Oc3ccc(Nc4nc(Cl)nc(Cl)n4)cc3)cc2)n1 |
| InChI | InChI=1S/C18H10Cl4N8O/c19-13-25-14(20)28-17(27-13)23-9-1-5-11(6-2-9)31-12-7-3-10(4-8-12)24-18-29-15(21)26-16(22)30-18/h1-8H,(H,23,25,27,28)(H,24,26,29,30) |
| InChIKey | RZTNRIKBPISYIR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 110.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.15 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |