C33H29Cl2N5O2 — CID 102288247
4,6-dichloro-N-[4-[(E)-2-[4-(4-ethoxy-N-(4-ethoxyphenyl)anilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-amine (PubChem CID 102288247) has the molecular formula C33H29Cl2N5O2 and a molecular weight of 598.53 g/mol. Its IUPAC name is 4,6-dichloro-N-[4-[(E)-2-[4-(4-ethoxy-N-(4-ethoxyphenyl)anilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-[4-[(E)-2-[4-(4-ethoxy-N-(4-ethoxyphenyl)anilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 102288247 |
| Molecular Formula | C33H29Cl2N5O2 |
| Molecular Weight | 598.53 g/mol |
| Exact Mass | 597.17 |
| IUPAC Name | 4,6-dichloro-N-[4-[(E)-2-[4-(4-ethoxy-N-(4-ethoxyphenyl)anilino)phenyl]ethenyl]phenyl]-1,3,5-triazin-2-amine |
| SMILES | CCOc1ccc(N(c2ccc(/C=C/c3ccc(Nc4nc(Cl)nc(Cl)n4)cc3)cc2)c2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C33H29Cl2N5O2/c1-3-41-29-19-15-27(16-20-29)40(28-17-21-30(22-18-28)42-4-2)26-13-9-24(10-14-26)6-5-23-7-11-25(12-8-23)36-33-38-31(34)37-32(35)39-33/h5-22H,3-4H2,1-2H3,(H,36,37,38,39)/b6-5+ |
| InChIKey | HPQDEGKJBTXRRI-AATRIKPKSA-N |
| XLogP | 9.36 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.53 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|