C20H12Cl4N8O6S2 — CID 100918856
5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[1-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid (PubChem CID 100918856) has the molecular formula C20H12Cl4N8O6S2 and a molecular weight of 666.31 g/mol. Its IUPAC name is 5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[1-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid.
| Compound Name | 5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[1-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 100918856 |
| Molecular Formula | C20H12Cl4N8O6S2 |
| Molecular Weight | 666.31 g/mol |
| Exact Mass | 663.91 |
| IUPAC Name | 5-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-[1-[4-[(4,6-dichloro-1,3,5-triazin-2-yl)amino]-2-sulfophenyl]ethenyl]benzenesulfonic acid |
| SMILES | C=C(c1ccc(Nc2nc(Cl)nc(Cl)n2)cc1S(=O)(=O)O)c1ccc(Nc2nc(Cl)nc(Cl)n2)cc1S(=O)(=O)O |
| InChI | InChI=1S/C20H12Cl4N8O6S2/c1-8(11-4-2-9(6-13(11)39(33,34)35)25-19-29-15(21)27-16(22)30-19)12-5-3-10(7-14(12)40(36,37)38)26-20-31-17(23)28-18(24)32-20/h2-7H,1H2,(H,33,34,35)(H,36,37,38)(H,25,27,29,30)(H,26,28,31,32) |
| InChIKey | CCCVGUSHZJHOIB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 210.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.31 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|