C11H11ClN4O3S — CID 21343192
4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-methylbenzenesulfonic acid (PubChem CID 21343192) has the molecular formula C11H11ClN4O3S and a molecular weight of 314.75 g/mol. Its IUPAC name is 4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-methylbenzenesulfonic acid.
| Compound Name | 4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 21343192 |
| Molecular Formula | C11H11ClN4O3S |
| Molecular Weight | 314.75 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-[(4-chloro-6-methyl-1,3,5-triazin-2-yl)amino]-2-methylbenzenesulfonic acid |
| SMILES | Cc1nc(Cl)nc(Nc2ccc(S(=O)(=O)O)c(C)c2)n1 |
| InChI | InChI=1S/C11H11ClN4O3S/c1-6-5-8(3-4-9(6)20(17,18)19)15-11-14-7(2)13-10(12)16-11/h3-5H,1-2H3,(H,17,18,19)(H,13,14,15,16) |
| InChIKey | MFYOAMKGDOUXCL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.75 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|