C16H14FN5O6S2 — CID 59858293
4-[[4-fluoro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid (PubChem CID 59858293) has the molecular formula C16H14FN5O6S2 and a molecular weight of 455.45 g/mol. Its IUPAC name is 4-[[4-fluoro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid.
| Compound Name | 4-[[4-fluoro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 59858293 |
| Molecular Formula | C16H14FN5O6S2 |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | 4-[[4-fluoro-6-(2-sulfoanilino)-1,3,5-triazin-2-yl]amino]-2-methylbenzenesulfonic acid |
| SMILES | Cc1cc(Nc2nc(F)nc(Nc3ccccc3S(=O)(=O)O)n2)ccc1S(=O)(=O)O |
| InChI | InChI=1S/C16H14FN5O6S2/c1-9-8-10(6-7-12(9)29(23,24)25)18-15-20-14(17)21-16(22-15)19-11-4-2-3-5-13(11)30(26,27)28/h2-8H,1H3,(H,23,24,25)(H,26,27,28)(H2,18,19,20,21,22) |
| InChIKey | COULBTDLFNISFC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 171.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|