C29H22FN9O10S3 — CID 136612206
3-[4-[[5-[[4-fluoro-6-(2-methylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxypyrazol-1-yl]naphthalene-1,5-disulfonic acid (PubChem CID 136612206) has the molecular formula C29H22FN9O10S3 and a molecular weight of 771.75 g/mol. Its IUPAC name is 3-[4-[[5-[[4-fluoro-6-(2-methylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxypyrazol-1-yl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[4-[[5-[[4-fluoro-6-(2-methylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxypyrazol-1-yl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 136612206 |
| Molecular Formula | C29H22FN9O10S3 |
| Molecular Weight | 771.75 g/mol |
| Exact Mass | 771.06 |
| IUPAC Name | 3-[4-[[5-[[4-fluoro-6-(2-methylanilino)-1,3,5-triazin-2-yl]amino]-2-sulfophenyl]diazenyl]-5-hydroxypyrazol-1-yl]naphthalene-1,5-disulfonic acid |
| SMILES | Cc1ccccc1Nc1nc(F)nc(Nc2ccc(S(=O)(=O)O)c(/N=N/c3cnn(-c4cc(S(=O)(=O)O)c5cccc(S(=O)(=O)O)c5c4)c3O)c2)n1 |
| InChI | InChI=1S/C29H22FN9O10S3/c1-15-5-2-3-7-20(15)33-29-35-27(30)34-28(36-29)32-16-9-10-24(51(44,45)46)21(11-16)37-38-22-14-31-39(26(22)40)17-12-19-18(25(13-17)52(47,48)49)6-4-8-23(19)50(41,42)43/h2-14,40H,1H3,(H,41,42,43)(H,44,45,46)(H,47,48,49)(H2,32,33,34,35,36)/b38-37+ |
| InChIKey | WEBXDZDXVHHUTJ-HEFFKOSUSA-N |
| XLogP | 5.01 |
| TPSA | 288.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.75 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|