C21H14FN7Na2O8S2 — CID 101147844
disodium;N-[2-[(4,8-disulfonaphthalen-2-yl)diazenyl]-5-[(4-fluoro-6-oxido-1,3,5-triazin-2-yl)amino]phenyl]ethanimidate (PubChem CID 101147844) has the molecular formula C21H14FN7Na2O8S2 and a molecular weight of 621.50 g/mol. Its IUPAC name is disodium;N-[2-[(4,8-disulfonaphthalen-2-yl)diazenyl]-5-[(4-fluoro-6-oxido-1,3,5-triazin-2-yl)amino]phenyl]ethanimidate.
| Compound Name | disodium;N-[2-[(4,8-disulfonaphthalen-2-yl)diazenyl]-5-[(4-fluoro-6-oxido-1,3,5-triazin-2-yl)amino]phenyl]ethanimidate |
|---|---|
| PubChem CID | 101147844 |
| Molecular Formula | C21H14FN7Na2O8S2 |
| Molecular Weight | 621.50 g/mol |
| Exact Mass | 621.01 |
| IUPAC Name | disodium;N-[2-[(4,8-disulfonaphthalen-2-yl)diazenyl]-5-[(4-fluoro-6-oxido-1,3,5-triazin-2-yl)amino]phenyl]ethanimidate |
| SMILES | C/C([O-])=N\c1cc(Nc2nc([O-])nc(F)n2)ccc1/N=N/c1cc(S(=O)(=O)O)c2cccc(S(=O)(=O)O)c2c1.[Na+].[Na+] |
| InChI | InChI=1S/C21H16FN7O8S2.2Na/c1-10(30)23-16-8-11(24-20-25-19(22)26-21(31)27-20)5-6-15(16)29-28-12-7-14-13(18(9-12)39(35,36)37)3-2-4-17(14)38(32,33)34;;/h2-9H,1H3,(H,23,30)(H,32,33,34)(H,35,36,37)(H2,24,25,26,27,31);;/q;2*+1/p-2/b29-28+;; |
| InChIKey | JBDOKXAYOIGQMR-NTDCDQSISA-L |
| XLogP | -3.69 |
| TPSA | 242.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.50 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|