C22H20N6O6S2 — CID 20677980
3-[[4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid (PubChem CID 20677980) has the molecular formula C22H20N6O6S2 and a molecular weight of 528.57 g/mol. Its IUPAC name is 3-[[4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid.
| Compound Name | 3-[[4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 20677980 |
| Molecular Formula | C22H20N6O6S2 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | 3-[[4-[(4,6-dimethyl-1,3,5-triazin-2-yl)amino]-2-methylphenyl]diazenyl]naphthalene-1,5-disulfonic acid |
| SMILES | Cc1nc(C)nc(Nc2ccc(/N=N/c3cc(S(=O)(=O)O)c4cccc(S(=O)(=O)O)c4c3)c(C)c2)n1 |
| InChI | InChI=1S/C22H20N6O6S2/c1-12-9-15(26-22-24-13(2)23-14(3)25-22)7-8-19(12)28-27-16-10-18-17(21(11-16)36(32,33)34)5-4-6-20(18)35(29,30)31/h4-11H,1-3H3,(H,29,30,31)(H,32,33,34)(H,23,24,25,26)/b28-27+ |
| InChIKey | KKVRHEHRAPDADH-BYYHNAKLSA-N |
| XLogP | 4.60 |
| TPSA | 184.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|